C23H29N5O2S — CID 111372639
1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111372639) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111372639 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C23H29N5O2S/c1-2-24-23(26-13-15-31-20-6-4-3-5-7-20)27-16-18-8-10-19(11-9-18)22(30)28-14-12-25-21(29)17-28/h3-11H,2,12-17H2,1H3,(H,25,29)(H2,24,26,27) |
| InChIKey | DGMSMPKGMNRXEQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|