C20H26IN5O3 — CID 110937135
1-ethyl-3-(furan-2-ylmethyl)-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110937135) has the molecular formula C20H26IN5O3 and a molecular weight of 511.36 g/mol. Its IUPAC name is 1-ethyl-3-(furan-2-ylmethyl)-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(furan-2-ylmethyl)-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110937135 |
| Molecular Formula | C20H26IN5O3 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1-ethyl-3-(furan-2-ylmethyl)-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCc1ccco1.I |
| InChI | InChI=1S/C20H25N5O3.HI/c1-2-21-20(24-13-17-4-3-11-28-17)23-12-15-5-7-16(8-6-15)19(27)25-10-9-22-18(26)14-25;/h3-8,11H,2,9-10,12-14H2,1H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | YDZUWQXZLNVMFM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|