C18H24F3N5O2 — CID 109473787
1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473787) has the molecular formula C18H24F3N5O2 and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473787 |
| Molecular Formula | C18H24F3N5O2 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCCC(F)(F)F |
| InChI | InChI=1S/C18H24F3N5O2/c1-2-22-17(24-8-7-18(19,20)21)25-11-13-3-5-14(6-4-13)16(28)26-10-9-23-15(27)12-26/h3-6H,2,7-12H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | ANNWIUMQHGIZAW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|