C25H34IN5O2 — CID 111048691
1-butyl-3-[(4-methylphenyl)methyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111048691) has the molecular formula C25H34IN5O2 and a molecular weight of 563.48 g/mol. Its IUPAC name is 1-butyl-3-[(4-methylphenyl)methyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-[(4-methylphenyl)methyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111048691 |
| Molecular Formula | C25H34IN5O2 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 1-butyl-3-[(4-methylphenyl)methyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCc1ccc(C)cc1.I |
| InChI | InChI=1S/C25H33N5O2.HI/c1-3-4-13-27-25(28-16-20-7-5-19(2)6-8-20)29-17-21-9-11-22(12-10-21)24(32)30-15-14-26-23(31)18-30;/h5-12H,3-4,13-18H2,1-2H3,(H,26,31)(H2,27,28,29);1H |
| InChIKey | PVICYHMVONACKI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|