C23H34IN7O2 — CID 111278336
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111278336) has the molecular formula C23H34IN7O2 and a molecular weight of 567.48 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111278336 |
| Molecular Formula | C23H34IN7O2 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C23H33N7O2.HI/c1-4-24-23(26-10-5-12-30-18(3)14-17(2)28-30)27-15-19-6-8-20(9-7-19)22(32)29-13-11-25-21(31)16-29;/h6-9,14H,4-5,10-13,15-16H2,1-3H3,(H,25,31)(H2,24,26,27);1H |
| InChIKey | ZCABFPZTOHDZSY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|