C25H33N5O — CID 110995951
N-butyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide (PubChem CID 110995951) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is N-butyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-butyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110995951 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | N-butyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(C/N=C(\NCC)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H33N5O/c1-3-5-15-27-24(31)20-12-10-19(11-13-20)17-30-25(26-4-2)28-16-14-21-18-29-23-9-7-6-8-22(21)23/h6-13,18,29H,3-5,14-17H2,1-2H3,(H,27,31)(H2,26,28,30) |
| InChIKey | UJDHTHXLAMTGSQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|