C23H31FIN5 — CID 111826716
2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111826716) has the molecular formula C23H31FIN5 and a molecular weight of 523.44 g/mol. Its IUPAC name is 2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111826716 |
| Molecular Formula | C23H31FIN5 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(CN(C)C)c1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C23H30FN5.HI/c1-4-25-23(26-12-11-18-15-27-22-8-6-5-7-20(18)22)28-14-17-9-10-21(24)19(13-17)16-29(2)3;/h5-10,13,15,27H,4,11-12,14,16H2,1-3H3,(H2,25,26,28);1H |
| InChIKey | MMBXSRNCAZNMJF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|