C20H26ClFN4 — CID 111827503
1-[(4-chlorophenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-ethylguanidine (PubChem CID 111827503) has the molecular formula C20H26ClFN4 and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-ethylguanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111827503 |
| Molecular Formula | C20H26ClFN4 |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(CN(C)C)c1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClFN4/c1-4-23-20(24-12-15-5-8-18(21)9-6-15)25-13-16-7-10-19(22)17(11-16)14-26(2)3/h5-11H,4,12-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | AEDVHAOKNZVISW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|