C17H29FN4O — CID 111826314
2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-(3-methoxypropyl)guanidine (PubChem CID 111826314) has the molecular formula C17H29FN4O and a molecular weight of 324.44 g/mol. Its IUPAC name is 2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-(3-methoxypropyl)guanidine.
| Compound Name | 2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 111826314 |
| Molecular Formula | C17H29FN4O |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-1-ethyl-3-(3-methoxypropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(CN(C)C)c1)NCCCOC |
| InChI | InChI=1S/C17H29FN4O/c1-5-19-17(20-9-6-10-23-4)21-12-14-7-8-16(18)15(11-14)13-22(2)3/h7-8,11H,5-6,9-10,12-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | WMLADOGNKVRAFA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|