C24H33N5O — CID 110995201
2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine (PubChem CID 110995201) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110995201 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCCN(C)C)c1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H33N5O/c1-4-25-24(26-13-12-20-18-27-23-11-6-5-10-22(20)23)28-17-19-8-7-9-21(16-19)30-15-14-29(2)3/h5-11,16,18,27H,4,12-15,17H2,1-3H3,(H2,25,26,28) |
| InChIKey | VFRCHFOGFAICNH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|