C22H40N6O — CID 111718130
1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111718130) has the molecular formula C22H40N6O and a molecular weight of 404.60 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111718130 |
| Molecular Formula | C22H40N6O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)NCCC(OCC)C(C)C |
| InChI | InChI=1S/C22H40N6O/c1-6-23-22(24-11-10-20(18(3)4)29-7-2)26-17-19-8-9-21(25-16-19)28-14-12-27(5)13-15-28/h8-9,16,18,20H,6-7,10-15,17H2,1-5H3,(H2,23,24,26) |
| InChIKey | KSOGXGVUBRMTQX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|