C20H36N4S — CID 110997735
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine (PubChem CID 110997735) has the molecular formula C20H36N4S and a molecular weight of 364.60 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110997735 |
| Molecular Formula | C20H36N4S |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(SC)cc1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C20H36N4S/c1-6-21-20(22-16-18-11-13-19(25-5)14-12-18)23-17(4)10-9-15-24(7-2)8-3/h11-14,17H,6-10,15-16H2,1-5H3,(H2,21,22,23) |
| InChIKey | UQHOZMWUCQPQCW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|