C23H42N6O — CID 110999375
1-[4-[[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 110999375) has the molecular formula C23H42N6O and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-[4-[[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 110999375 |
| Molecular Formula | C23H42N6O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 1-[4-[[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C23H42N6O/c1-7-24-22(27-19(6)11-10-16-29(8-2)9-3)25-17-20-12-14-21(15-13-20)28-23(30)26-18(4)5/h12-15,18-19H,7-11,16-17H2,1-6H3,(H2,24,25,27)(H2,26,28,30) |
| InChIKey | NRFAKHMZTMFJRI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|