C14H23IN4O2S — CID 110982056
1-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110982056) has the molecular formula C14H23IN4O2S and a molecular weight of 438.34 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110982056 |
| Molecular Formula | C14H23IN4O2S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1ccc(S(=O)(=O)NC)cc1)NCC.I |
| InChI | InChI=1S/C14H22N4O2S.HI/c1-4-10-17-14(16-5-2)18-11-12-6-8-13(9-7-12)21(19,20)15-3;/h4,6-9,15H,1,5,10-11H2,2-3H3,(H2,16,17,18);1H |
| InChIKey | DZPRBBWEXVOTPO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|