C13H21IN4O2S — CID 110980478
1-ethyl-3-prop-2-enyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 110980478) has the molecular formula C13H21IN4O2S and a molecular weight of 424.31 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-enyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-prop-2-enyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110980478 |
| Molecular Formula | C13H21IN4O2S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 1-ethyl-3-prop-2-enyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1cccc(S(N)(=O)=O)c1)NCC.I |
| InChI | InChI=1S/C13H20N4O2S.HI/c1-3-8-16-13(15-4-2)17-10-11-6-5-7-12(9-11)20(14,18)19;/h3,5-7,9H,1,4,8,10H2,2H3,(H2,14,18,19)(H2,15,16,17);1H |
| InChIKey | BMOHYOWDNBUJKK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|