C20H27N5O3S — CID 111875099
4-[[[N-ethyl-N'-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111875099) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is 4-[[[N-ethyl-N'-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[N-ethyl-N'-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111875099 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[[[N-ethyl-N'-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NCc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H27N5O3S/c1-4-22-20(24-14-16-6-5-7-18(12-16)29(21,27)28)23-13-15-8-10-17(11-9-15)19(26)25(2)3/h5-12H,4,13-14H2,1-3H3,(H2,21,27,28)(H2,22,23,24) |
| InChIKey | CXFGLZGRVTWJFA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|