C19H26IN5O3S — CID 111872802
N,N-dimethyl-4-[[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111872802) has the molecular formula C19H26IN5O3S and a molecular weight of 531.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111872802 |
| Molecular Formula | C19H26IN5O3S |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCc1cccc(S(N)(=O)=O)c1.I |
| InChI | InChI=1S/C19H25N5O3S.HI/c1-21-19(23-13-15-5-4-6-17(11-15)28(20,26)27)22-12-14-7-9-16(10-8-14)18(25)24(2)3;/h4-11H,12-13H2,1-3H3,(H2,20,26,27)(H2,21,22,23);1H |
| InChIKey | ZPABAKIUNAEXHN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|