C15H26IN5O3S — CID 111383745
N-tert-butyl-2-[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111383745) has the molecular formula C15H26IN5O3S and a molecular weight of 483.38 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111383745 |
| Molecular Formula | C15H26IN5O3S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[(3-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1cccc(S(N)(=O)=O)c1.I |
| InChI | InChI=1S/C15H25N5O3S.HI/c1-15(2,3)20-13(21)10-19-14(17-4)18-9-11-6-5-7-12(8-11)24(16,22)23;/h5-8H,9-10H2,1-4H3,(H,20,21)(H2,16,22,23)(H2,17,18,19);1H |
| InChIKey | GURPNCQKJARWKL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|