C15H24FIN4O2 — CID 111797343
N-tert-butyl-2-[[N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111797343) has the molecular formula C15H24FIN4O2 and a molecular weight of 438.29 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111797343 |
| Molecular Formula | C15H24FIN4O2 |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-tert-butyl-2-[[N-[(3-fluoro-4-hydroxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccc(O)c(F)c1.I |
| InChI | InChI=1S/C15H23FN4O2.HI/c1-15(2,3)20-13(22)9-19-14(17-4)18-8-10-5-6-12(21)11(16)7-10;/h5-7,21H,8-9H2,1-4H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | XTJKIKVAQQBYOY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|