C18H29FIN5O2 — CID 111385169
N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111385169) has the molecular formula C18H29FIN5O2 and a molecular weight of 493.37 g/mol. Its IUPAC name is N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111385169 |
| Molecular Formula | C18H29FIN5O2 |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)Cc1ccc(F)cc1)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C18H28FN5O2.HI/c1-18(2,3)24-16(26)12-23-17(20-4)22-10-9-21-15(25)11-13-5-7-14(19)8-6-13;/h5-8H,9-12H2,1-4H3,(H,21,25)(H,24,26)(H2,20,22,23);1H |
| InChIKey | IBYLWAMWWBNASQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|