C18H28FN5O2 — CID 111385668
N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111385668) has the molecular formula C18H28FN5O2 and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111385668 |
| Molecular Formula | C18H28FN5O2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C)c(F)c1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H28FN5O2/c1-12-6-7-13(10-14(12)19)16(26)21-8-9-22-17(20-5)23-11-15(25)24-18(2,3)4/h6-7,10H,8-9,11H2,1-5H3,(H,21,26)(H,24,25)(H2,20,22,23) |
| InChIKey | OYSNFZSDPBAEHO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|