C18H28BrN5O2 — CID 111383899
4-bromo-N-[3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]benzamide (PubChem CID 111383899) has the molecular formula C18H28BrN5O2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 4-bromo-N-[3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]benzamide.
| Compound Name | 4-bromo-N-[3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111383899 |
| Molecular Formula | C18H28BrN5O2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-bromo-N-[3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(/NCCCNC(=O)c1ccc(Br)cc1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H28BrN5O2/c1-18(2,3)24-15(25)12-23-17(20-4)22-11-5-10-21-16(26)13-6-8-14(19)9-7-13/h6-9H,5,10-12H2,1-4H3,(H,21,26)(H,24,25)(H2,20,22,23) |
| InChIKey | IJXZWOMFJBOCEE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|