C18H29BrN4O — CID 111385018
2-[[N-[2-(4-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide (PubChem CID 111385018) has the molecular formula C18H29BrN4O and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-[[N-[2-(4-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[N-[2-(4-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111385018 |
| Molecular Formula | C18H29BrN4O |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[[N-[2-(4-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC(C)(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H29BrN4O/c1-17(2,3)23-15(24)11-21-16(20-6)22-12-18(4,5)13-7-9-14(19)10-8-13/h7-10H,11-12H2,1-6H3,(H,23,24)(H2,20,21,22) |
| InChIKey | PTWNHGGHRUXJJM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|