C12H27IN4O — CID 110965911
N-tert-butyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide;hydroiodide (PubChem CID 110965911) has the molecular formula C12H27IN4O and a molecular weight of 370.28 g/mol. Its IUPAC name is N-tert-butyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110965911 |
| Molecular Formula | C12H27IN4O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-tert-butyl-2-[(N-tert-butyl-N'-methylcarbamimidoyl)amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NC(C)(C)C.I |
| InChI | InChI=1S/C12H26N4O.HI/c1-11(2,3)15-9(17)8-14-10(13-7)16-12(4,5)6;/h8H2,1-7H3,(H,15,17)(H2,13,14,16);1H |
| InChIKey | LEFUBLLOAGGFSG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|