C12H24N4O3 — CID 111383586
methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate (PubChem CID 111383586) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate.
| Compound Name | methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111383586 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H24N4O3/c1-12(2,3)16-9(17)8-15-11(13-4)14-7-6-10(18)19-5/h6-8H2,1-5H3,(H,16,17)(H2,13,14,15) |
| InChIKey | AIYJGHTVDOGSBN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|