C15H30N4O3 — CID 111384225
methyl 6-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]hexanoate (PubChem CID 111384225) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl 6-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]hexanoate.
| Compound Name | methyl 6-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]hexanoate |
|---|---|
| PubChem CID | 111384225 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | methyl 6-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]hexanoate |
| SMILES | C/N=C(\NCCCCCC(=O)OC)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H30N4O3/c1-15(2,3)19-12(20)11-18-14(16-4)17-10-8-6-7-9-13(21)22-5/h6-11H2,1-5H3,(H,19,20)(H2,16,17,18) |
| InChIKey | CQTRFPRXZQIDQO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|