C13H29IN4O — CID 111128588
N-tert-butyl-2-[(N'-methyl-N-pentylcarbamimidoyl)amino]acetamide;hydroiodide (PubChem CID 111128588) has the molecular formula C13H29IN4O and a molecular weight of 384.31 g/mol. Its IUPAC name is N-tert-butyl-2-[(N'-methyl-N-pentylcarbamimidoyl)amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[(N'-methyl-N-pentylcarbamimidoyl)amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111128588 |
| Molecular Formula | C13H29IN4O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-tert-butyl-2-[(N'-methyl-N-pentylcarbamimidoyl)amino]acetamide;hydroiodide |
| SMILES | CCCCCN/C(=N\C)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C13H28N4O.HI/c1-6-7-8-9-15-12(14-5)16-10-11(18)17-13(2,3)4;/h6-10H2,1-5H3,(H,17,18)(H2,14,15,16);1H |
| InChIKey | QJMFNPHLVIGYNW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|