C12H25IN4O3 — CID 111383585
methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111383585) has the molecular formula C12H25IN4O3 and a molecular weight of 400.26 g/mol. Its IUPAC name is methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111383585 |
| Molecular Formula | C12H25IN4O3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | methyl 3-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C12H24N4O3.HI/c1-12(2,3)16-9(17)8-15-11(13-4)14-7-6-10(18)19-5;/h6-8H2,1-5H3,(H,16,17)(H2,13,14,15);1H |
| InChIKey | DTCOBBSCYQHSRJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|