C16H33IN4O4 — CID 111883522
methyl 6-[[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]hexanoate;hydroiodide (PubChem CID 111883522) has the molecular formula C16H33IN4O4 and a molecular weight of 472.37 g/mol. Its IUPAC name is methyl 6-[[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 111883522 |
| Molecular Formula | C16H33IN4O4 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | methyl 6-[[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]hexanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCCC(=O)OC)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H32N4O4.HI/c1-16(2,3)24-15(22)20-12-11-19-14(17-4)18-10-8-6-7-9-13(21)23-5;/h6-12H2,1-5H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | FTMIWQORUIXBMW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|