C11H24IN3O3 — CID 110940117
methyl 5-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 110940117) has the molecular formula C11H24IN3O3 and a molecular weight of 373.24 g/mol. Its IUPAC name is methyl 5-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 110940117 |
| Molecular Formula | C11H24IN3O3 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | methyl 5-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | C/N=C(/NCCCCC(=O)OC)NCCOC.I |
| InChI | InChI=1S/C11H23N3O3.HI/c1-12-11(14-8-9-16-2)13-7-5-4-6-10(15)17-3;/h4-9H2,1-3H3,(H2,12,13,14);1H |
| InChIKey | HFRPASOCSHVMNS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|