C17H36N4O2 — CID 111692592
methyl 5-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]pentanoate (PubChem CID 111692592) has the molecular formula C17H36N4O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is methyl 5-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]pentanoate.
| Compound Name | methyl 5-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 111692592 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | methyl 5-[[N-[3-[di(propan-2-yl)amino]propyl]-N'-methylcarbamimidoyl]amino]pentanoate |
| SMILES | C/N=C(\NCCCCC(=O)OC)NCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C17H36N4O2/c1-14(2)21(15(3)4)13-9-12-20-17(18-5)19-11-8-7-10-16(22)23-6/h14-15H,7-13H2,1-6H3,(H2,18,19,20) |
| InChIKey | CZXOCIZHJUGKHU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|