C14H31IN4O2 — CID 111247572
methyl 3-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111247572) has the molecular formula C14H31IN4O2 and a molecular weight of 414.33 g/mol. Its IUPAC name is methyl 3-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111247572 |
| Molecular Formula | C14H31IN4O2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | methyl 3-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C14H30N4O2.HI/c1-11(2)18(12(3)4)10-9-17-14(15-5)16-8-7-13(19)20-6;/h11-12H,7-10H2,1-6H3,(H2,15,16,17);1H |
| InChIKey | RNUXJTAWMVKTOF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|