C17H33IN4O4 — CID 109465689
tert-butyl 3-[[N-(6-methoxy-6-oxohexyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109465689) has the molecular formula C17H33IN4O4 and a molecular weight of 484.38 g/mol. Its IUPAC name is tert-butyl 3-[[N-(6-methoxy-6-oxohexyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-(6-methoxy-6-oxohexyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109465689 |
| Molecular Formula | C17H33IN4O4 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | tert-butyl 3-[[N-(6-methoxy-6-oxohexyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCCCC(=O)OC)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C17H32N4O4.HI/c1-17(2,3)25-16(23)21-11-13(12-21)20-15(18-4)19-10-8-6-7-9-14(22)24-5;/h13H,6-12H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | SBYPDBLCYVVGTP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|