C13H25FN4O2 — CID 109465532
tert-butyl 3-[[N-(3-fluoropropyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465532) has the molecular formula C13H25FN4O2 and a molecular weight of 288.37 g/mol. Its IUPAC name is tert-butyl 3-[[N-(3-fluoropropyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-(3-fluoropropyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465532 |
| Molecular Formula | C13H25FN4O2 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | tert-butyl 3-[[N-(3-fluoropropyl)-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCCF)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H25FN4O2/c1-13(2,3)20-12(19)18-8-10(9-18)17-11(15-4)16-7-5-6-14/h10H,5-9H2,1-4H3,(H2,15,16,17) |
| InChIKey | HZHYPYNVCLEBBT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|