C15H30N4O2S — CID 109466468
tert-butyl 3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466468) has the molecular formula C15H30N4O2S and a molecular weight of 330.50 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466468 |
| Molecular Formula | C15H30N4O2S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCCCSC)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H30N4O2S/c1-15(2,3)21-14(20)19-10-12(11-19)18-13(16-4)17-8-6-7-9-22-5/h12H,6-11H2,1-5H3,(H2,16,17,18) |
| InChIKey | HMCUWOGFUNFWNU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|