C17H32IN5O3 — CID 109465833
tert-butyl 3-[[N-[4-(cyclopropylamino)-4-oxobutyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109465833) has the molecular formula C17H32IN5O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is tert-butyl 3-[[N-[4-(cyclopropylamino)-4-oxobutyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-[4-(cyclopropylamino)-4-oxobutyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109465833 |
| Molecular Formula | C17H32IN5O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | tert-butyl 3-[[N-[4-(cyclopropylamino)-4-oxobutyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C17H31N5O3.HI/c1-17(2,3)25-16(24)22-10-13(11-22)21-15(18-4)19-9-5-6-14(23)20-12-7-8-12;/h12-13H,5-11H2,1-4H3,(H,20,23)(H2,18,19,21);1H |
| InChIKey | DGONKCUDPMZRNA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|