C18H35IN4O4 — CID 109466445
tert-butyl 3-[[N'-methyl-N-[3-(oxan-4-yloxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466445) has the molecular formula C18H35IN4O4 and a molecular weight of 498.41 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-[3-(oxan-4-yloxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-methyl-N-[3-(oxan-4-yloxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466445 |
| Molecular Formula | C18H35IN4O4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-[3-(oxan-4-yloxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCOC1CCOCC1)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C18H34N4O4.HI/c1-18(2,3)26-17(23)22-12-14(13-22)21-16(19-4)20-8-5-9-25-15-6-10-24-11-7-15;/h14-15H,5-13H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | UQIIOBSWFQBBEU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|