C18H35N5O4 — CID 109466498
tert-butyl 3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466498) has the molecular formula C18H35N5O4 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466498 |
| Molecular Formula | C18H35N5O4 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H35N5O4/c1-17(2,3)26-15(24)21-10-8-9-20-14(19-7)22-13-11-23(12-13)16(25)27-18(4,5)6/h13H,8-12H2,1-7H3,(H,21,24)(H2,19,20,22) |
| InChIKey | YGPWRMBESUQIPH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|