C20H38N6O3 — CID 109465816
tert-butyl 3-[[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465816) has the molecular formula C20H38N6O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is tert-butyl 3-[[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465816 |
| Molecular Formula | C20H38N6O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | tert-butyl 3-[[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCCCN1CCC(C(N)=O)CC1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H38N6O3/c1-20(2,3)29-19(28)26-13-16(14-26)24-18(22-4)23-9-5-6-10-25-11-7-15(8-12-25)17(21)27/h15-16H,5-14H2,1-4H3,(H2,21,27)(H2,22,23,24) |
| InChIKey | IYWVAWPJTYBVHW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|