C26H44N2O10 — CID 175487122
bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl] butanedioate (PubChem CID 175487122) has the molecular formula C26H44N2O10 and a molecular weight of 544.64 g/mol. Its IUPAC name is bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl] butanedioate.
| Compound Name | bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl] butanedioate |
|---|---|
| PubChem CID | 175487122 |
| Molecular Formula | C26H44N2O10 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl] butanedioate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)OC(=O)CCC(=O)OC(=O)CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H44N2O10/c1-25(2,3)37-23(33)27-17-11-7-9-13-19(29)35-21(31)15-16-22(32)36-20(30)14-10-8-12-18-28-24(34)38-26(4,5)6/h7-18H2,1-6H3,(H,27,33)(H,28,34) |
| InChIKey | POLNBRYZFGVJLN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|