C9H20N4O — CID 75532327
N-tert-butyl-2-[(N,N'-dimethylcarbamimidoyl)amino]acetamide (PubChem CID 75532327) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is N-tert-butyl-2-[(N,N'-dimethylcarbamimidoyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(N,N'-dimethylcarbamimidoyl)amino]acetamide |
|---|---|
| PubChem CID | 75532327 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | N-tert-butyl-2-[(N,N'-dimethylcarbamimidoyl)amino]acetamide |
| SMILES | C/N=C(\NC)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H20N4O/c1-9(2,3)13-7(14)6-12-8(10-4)11-5/h6H2,1-5H3,(H,13,14)(H2,10,11,12) |
| InChIKey | VUFSESFMTNQLPR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|