C17H35N5O3 — CID 111776144
tert-butyl N-[1-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate (PubChem CID 111776144) has the molecular formula C17H35N5O3 and a molecular weight of 357.50 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 111776144 |
| Molecular Formula | C17H35N5O3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | tert-butyl N-[1-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropan-2-yl]carbamate |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H35N5O3/c1-15(2,3)21-12(23)10-19-13(18-9)20-11-17(7,8)22-14(24)25-16(4,5)6/h10-11H2,1-9H3,(H,21,23)(H,22,24)(H2,18,19,20) |
| InChIKey | JWPRVEWTFLDSQF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|