C16H33N5O3 — CID 111385196
tert-butyl N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 111385196) has the molecular formula C16H33N5O3 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111385196 |
| Molecular Formula | C16H33N5O3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | tert-butyl N-[2-[[N-[2-(tert-butylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | C/N=C(/NCCN(C)C(=O)OC(C)(C)C)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H33N5O3/c1-15(2,3)20-12(22)11-19-13(17-7)18-9-10-21(8)14(23)24-16(4,5)6/h9-11H2,1-8H3,(H,20,22)(H2,17,18,19) |
| InChIKey | GAZPCKHHWJDXSM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|