C12H26N4O2 — CID 111498039
tert-butyl N-[1-[(N,N'-dimethylcarbamimidoyl)amino]-2-methylpropan-2-yl]carbamate (PubChem CID 111498039) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is tert-butyl N-[1-[(N,N'-dimethylcarbamimidoyl)amino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(N,N'-dimethylcarbamimidoyl)amino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 111498039 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | tert-butyl N-[1-[(N,N'-dimethylcarbamimidoyl)amino]-2-methylpropan-2-yl]carbamate |
| SMILES | C/N=C(\NC)NCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H26N4O2/c1-11(2,3)18-10(17)16-12(4,5)8-15-9(13-6)14-7/h8H2,1-7H3,(H,16,17)(H2,13,14,15) |
| InChIKey | MWXGBCNDUAZENN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|