C20H41N5O2 — CID 111774992
tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]propan-2-yl]carbamate (PubChem CID 111774992) has the molecular formula C20H41N5O2 and a molecular weight of 383.58 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 111774992 |
| Molecular Formula | C20H41N5O2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]propan-2-yl]carbamate |
| SMILES | C/N=C(\NCC(C)(C)NC(=O)OC(C)(C)C)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C20H41N5O2/c1-18(2,3)27-17(26)24-19(4,5)14-22-16(21-8)23-15-20(6,7)25-12-10-9-11-13-25/h9-15H2,1-8H3,(H,24,26)(H2,21,22,23) |
| InChIKey | URVRBQTUYNOVFQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|