C21H37N5O2S — CID 111771600
tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propan-2-yl]carbamate (PubChem CID 111771600) has the molecular formula C21H37N5O2S and a molecular weight of 423.63 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 111771600 |
| Molecular Formula | C21H37N5O2S |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propan-2-yl]carbamate |
| SMILES | C/N=C(/NCC(c1cccs1)N1CCCC1)NCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37N5O2S/c1-20(2,3)28-19(27)25-21(4,5)15-24-18(22-6)23-14-16(17-10-9-13-29-17)26-11-7-8-12-26/h9-10,13,16H,7-8,11-12,14-15H2,1-6H3,(H,25,27)(H2,22,23,24) |
| InChIKey | DWNLKBYJSNFANC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|