C22H31N5OS — CID 111012285
N-[3-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide (PubChem CID 111012285) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111012285 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[3-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(/NCCCNC(=O)c1ccccc1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C22H31N5OS/c1-23-22(25-13-8-12-24-21(28)18-9-3-2-4-10-18)26-17-19(20-11-7-16-29-20)27-14-5-6-15-27/h2-4,7,9-11,16,19H,5-6,8,12-15,17H2,1H3,(H,24,28)(H2,23,25,26) |
| InChIKey | LMLJIJDSHSPOTL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|