C21H30N4OS2 — CID 111760049
1-(2-benzylsulfinylethyl)-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111760049) has the molecular formula C21H30N4OS2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-(2-benzylsulfinylethyl)-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-(2-benzylsulfinylethyl)-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111760049 |
| Molecular Formula | C21H30N4OS2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-(2-benzylsulfinylethyl)-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCS(=O)Cc1ccccc1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H30N4OS2/c1-22-21(23-11-15-28(26)17-18-8-3-2-4-9-18)24-16-19(20-10-7-14-27-20)25-12-5-6-13-25/h2-4,7-10,14,19H,5-6,11-13,15-17H2,1H3,(H2,22,23,24) |
| InChIKey | SKJYQQWQQFXBGL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|