C18H34IN5O2S2 — CID 111760032
1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111760032) has the molecular formula C18H34IN5O2S2 and a molecular weight of 543.54 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111760032 |
| Molecular Formula | C18H34IN5O2S2 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C18H33N5O2S2.HI/c1-4-23(5-2)27(24,25)14-10-20-18(19-3)21-15-16(17-9-8-13-26-17)22-11-6-7-12-22;/h8-9,13,16H,4-7,10-12,14-15H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | IWNQOJPIBHAFNF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|