C20H30IN5O2S2 — CID 111012424
2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111012424) has the molecular formula C20H30IN5O2S2 and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111012424 |
| Molecular Formula | C20H30IN5O2S2 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC)cc1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C20H29N5O2S2.HI/c1-21-20(23-14-16-7-9-17(10-8-16)29(26,27)22-2)24-15-18(19-6-5-13-28-19)25-11-3-4-12-25;/h5-10,13,18,22H,3-4,11-12,14-15H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | WCFWQZOUWRRNBP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|